Sulfonyl halides
eMolecules 694471-97-1 | 4-(3-Pyridyloxy)benzenesulfonyl chloride hydrochloride | Chem-Impex | MFCD01862557 | 306.160 | C11H9Cl2NO3S | 95.000 | Cl.ClS(=O)(=O)c1ccc(Oc2cccnc2)cc1 | 1g | 272387961
4-(3-Pyridyloxy)benzenesulfonyl chloride hydrochloride | Chem-Impex | 694471-97-1 | MFCD01862557 | 306.160 | C11H9Cl2NO3S | 95.000 | Cl.ClS(=O)(=O)c1ccc(Oc2cccnc2)cc1 | 1g | 272387961
![Research Products International Corp AEBSF [4-(2-Aminoethyl)-benzenesulfonyl fluoride, HCl], 500 Milligrams](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00006095-A20010-0.5.JPG-250.jpg)
Research Products International Corp AEBSF [4-(2-Aminoethyl)-benzenesulfonyl fluoride, HCl], 500 Milligrams
Specific and irreversible inhibitor of serine proteases. Inhibits chymotrypsin, kallikrein, plasmin, thrombin, trypsin and other related thrombolytic enzymes. Less toxic substitute for PMSF.
Apexbio Technology LLC PMSF 329-98-6 10g
Phenylmethanesulfonyl fluoride (PMSF CAS 329-98-6) is an irreversible serine protease inhibitor widely utilized in biomedical research It covalently modifies serine residues within the active sites of targeted enzymes effectively inhibiting their catalytic function PMSF is commonly used to inhibit neuropathy target esterase (NTE) a protective enzyme involved in delayed neurotoxicity induced by organophosphates Its inhibition of NTE significantly enhances susceptibility to organophosphate-induced delayed neuropathy (OPIDP) Additionally PMSF specifically targets -glutamyl transpeptidase serving as an enzymatic site-directed inactivator to probe serine enzyme mechanisms
eMolecules 616-83-1 | Ambeed | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride | 1g | 625594005 | A241972 | MFCD00129811 | 235.64 | C7H6ClNO4S
Ambeed | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride | 1g | 625594005 | A241972 | 616-83-1 | MFCD00129811 | 235.640 | C7H6ClNO4S